C22H18F3N3O3 — CID 68845366
N-(5-methoxy-3-pyridinyl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 68845366) has the molecular formula C22H18F3N3O3 and a molecular weight of 429.40 g/mol. Its IUPAC name is N-(5-methoxy-3-pyridinyl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | N-(5-methoxy-3-pyridinyl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 68845366 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-(5-methoxy-3-pyridinyl)-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | COc1cncc(NC(=O)c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2C)c1 |
| InChI | InChI=1S/C22H18F3N3O3/c1-13-6-7-16(27-20(29)14-4-3-5-15(8-14)22(23,24)25)10-19(13)21(30)28-17-9-18(31-2)12-26-11-17/h3-12H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | WSQBCQHYOIDWSX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |