About cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione
cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione (PubChem CID 68845454) has the molecular formula C10H15NO5
and a molecular weight of 229.23 g/mol. Its IUPAC name is cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione |
| PubChem CID | 68845454 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione |
| SMILES | O=C(O)OC1CCCC1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C6H10O3.C4H5NO2/c7-6(8)9-5-3-1-2-4-5;6-3-1-2-4(7)5-3/h5H,1-4H2,(H,7,8);1-2H2,(H,5,6,7) |
| InChIKey | VEMZCQFHKZWMOY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione?
The IUPAC name of cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione (CID 68845454) is cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione.
What is the SMILES notation for cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione?
The canonical SMILES for cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione is O=C(O)OC1CCCC1.O=C1CCC(=O)N1.
What is the InChIKey of cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione?
The InChIKey is VEMZCQFHKZWMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H5NO2/c7-6(8)9-5-3-1-2-4-5;6-3-1-2-4(7)5-3/h5H,1-4H2,(H,7,8);1-2H2,(H,5,6,7).
What are the key properties of cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione?
cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione has a molecular weight of 229.23 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl hydrogen carbonate;pyrrolidine-2,5-dione is sourced from PubChem (CID 68845454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).