C12H15N — CID 68845701
6-(3-methylphenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 68845701) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 6-(3-methylphenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(3-methylphenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 68845701 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 6-(3-methylphenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | Cc1cccc(C2=NCCCC2)c1 |
| InChI | InChI=1S/C12H15N/c1-10-5-4-6-11(9-10)12-7-2-3-8-13-12/h4-6,9H,2-3,7-8H2,1H3 |
| InChIKey | BUUFQMSIVSLYGH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |