About 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one
4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one (PubChem CID 68845948) has the molecular formula C20H23NO3
and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one |
| PubChem CID | 68845948 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one |
| SMILES | COCCCN1C(=O)C(C)(c2ccccc2)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C20H23NO3/c1-15-10-11-18-17(14-15)21(12-7-13-23-3)19(22)20(2,24-18)16-8-5-4-6-9-16/h4-6,8-11,14H,7,12-13H2,1-3H3 |
| InChIKey | FDJHAMRRTFNDBG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one?
The IUPAC name of 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one (CID 68845948) is 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one?
The canonical SMILES for 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one is COCCCN1C(=O)C(C)(c2ccccc2)Oc2ccc(C)cc21.
What is the InChIKey of 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one?
The InChIKey is FDJHAMRRTFNDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-15-10-11-18-17(14-15)21(12-7-13-23-3)19(22)20(2,24-18)16-8-5-4-6-9-16/h4-6,8-11,14H,7,12-13H2,1-3H3.
What are the key properties of 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one?
4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one has a molecular weight of 325.41 g/mol, XLogP of 3.67, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxypropyl)-2,6-dimethyl-2-phenyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 68845948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).