About [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate
[2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate (PubChem CID 68846324) has the molecular formula C11H8N2O4
and a molecular weight of 232.20 g/mol. Its IUPAC name is [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate.
Molecular Properties
| Compound Name | [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate |
| PubChem CID | 68846324 |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate |
| SMILES | NC(=O)Oc1ccccc1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H8N2O4/c12-11(16)17-8-4-2-1-3-7(8)13-9(14)5-6-10(13)15/h1-6H,(H2,12,16) |
| InChIKey | NCNCEQOMVFQLST-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate?
The IUPAC name of [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate (CID 68846324) is [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate.
What is the SMILES notation for [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate?
The canonical SMILES for [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate is NC(=O)Oc1ccccc1N1C(=O)C=CC1=O.
What is the InChIKey of [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate?
The InChIKey is NCNCEQOMVFQLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O4/c12-11(16)17-8-4-2-1-3-7(8)13-9(14)5-6-10(13)15/h1-6H,(H2,12,16).
What are the key properties of [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate?
[2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate has a molecular weight of 232.20 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dioxopyrrol-1-yl)phenyl] carbamate is sourced from PubChem (CID 68846324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).