About tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride
tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride (PubChem CID 68846414) has the molecular formula C17H29ClN4O2
and a molecular weight of 356.90 g/mol. Its IUPAC name is tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride |
| PubChem CID | 68846414 |
| Molecular Formula | C17H29ClN4O2 |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)CC1.Cl.N#CC1CCNCC1 |
| InChI | InChI=1S/C11H18N2O2.C6H10N2.ClH/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13;7-5-6-1-3-8-4-2-6;/h9H,4-7H2,1-3H3;6,8H,1-4H2;1H |
| InChIKey | UJCIAOVXPVNUOU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride?
The IUPAC name of tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride (CID 68846414) is tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride.
What is the SMILES notation for tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride?
The canonical SMILES for tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride is CC(C)(C)OC(=O)N1CCC(C#N)CC1.Cl.N#CC1CCNCC1.
What is the InChIKey of tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride?
The InChIKey is UJCIAOVXPVNUOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2.C6H10N2.ClH/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13;7-5-6-1-3-8-4-2-6;/h9H,4-7H2,1-3H3;6,8H,1-4H2;1H.
What are the key properties of tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride?
tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride has a molecular weight of 356.90 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-cyanopiperidine-1-carboxylate;piperidine-4-carbonitrile;hydrochloride is sourced from PubChem (CID 68846414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).