About 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid
4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 68846597) has the molecular formula C15H16FN5O4
and a molecular weight of 349.32 g/mol. Its IUPAC name is 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 68846597 |
| Molecular Formula | C15H16FN5O4 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | Nc1ccc(F)cc1.O=C1CCC(C(=O)Nc2cn[nH]c2C(=O)O)N1 |
| InChI | InChI=1S/C9H10N4O4.C6H6FN/c14-6-2-1-4(11-6)8(15)12-5-3-10-13-7(5)9(16)17;7-5-1-3-6(8)4-2-5/h3-4H,1-2H2,(H,10,13)(H,11,14)(H,12,15)(H,16,17);1-4H,8H2 |
| InChIKey | AGQBUORYRYIUMN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid (CID 68846597) is 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid is Nc1ccc(F)cc1.O=C1CCC(C(=O)Nc2cn[nH]c2C(=O)O)N1.
What is the InChIKey of 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid?
The InChIKey is AGQBUORYRYIUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O4.C6H6FN/c14-6-2-1-4(11-6)8(15)12-5-3-10-13-7(5)9(16)17;7-5-1-3-6(8)4-2-5/h3-4H,1-2H2,(H,10,13)(H,11,14)(H,12,15)(H,16,17);1-4H,8H2.
What are the key properties of 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid?
4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid has a molecular weight of 349.32 g/mol, XLogP of 0.73, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoroaniline;4-[(5-oxopyrrolidine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 68846597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).