About [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate
[4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate (PubChem CID 68846908) has the molecular formula C14H13NO4
and a molecular weight of 259.26 g/mol. Its IUPAC name is [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate.
Molecular Properties
| Compound Name | [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate |
| PubChem CID | 68846908 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(C=C2N=C(C)OC2=O)cc1 |
| InChI | InChI=1S/C14H13NO4/c1-9-15-13(14(17)19-9)7-11-3-5-12(6-4-11)8-18-10(2)16/h3-7H,8H2,1-2H3 |
| InChIKey | HCZDUFMTHVOYNB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate?
The IUPAC name of [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate (CID 68846908) is [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate.
What is the SMILES notation for [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate?
The canonical SMILES for [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate is CC(=O)OCc1ccc(C=C2N=C(C)OC2=O)cc1.
What is the InChIKey of [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate?
The InChIKey is HCZDUFMTHVOYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c1-9-15-13(14(17)19-9)7-11-3-5-12(6-4-11)8-18-10(2)16/h3-7H,8H2,1-2H3.
What are the key properties of [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate?
[4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate has a molecular weight of 259.26 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl]methyl acetate is sourced from PubChem (CID 68846908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).