C19H18IN3O5 — CID 68847232
2-[(1-cyano-6-cyclohexyloxy-4-hydroxy-5-iodoisoquinoline-3-carbonyl)amino]acetic acid (PubChem CID 68847232) has the molecular formula C19H18IN3O5 and a molecular weight of 495.27 g/mol. Its IUPAC name is 2-[(1-cyano-6-cyclohexyloxy-4-hydroxy-5-iodoisoquinoline-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(1-cyano-6-cyclohexyloxy-4-hydroxy-5-iodoisoquinoline-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 68847232 |
| Molecular Formula | C19H18IN3O5 |
| Molecular Weight | 495.27 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 2-[(1-cyano-6-cyclohexyloxy-4-hydroxy-5-iodoisoquinoline-3-carbonyl)amino]acetic acid |
| SMILES | N#Cc1nc(C(=O)NCC(=O)O)c(O)c2c(I)c(OC3CCCCC3)ccc12 |
| InChI | InChI=1S/C19H18IN3O5/c20-16-13(28-10-4-2-1-3-5-10)7-6-11-12(8-21)23-17(18(26)15(11)16)19(27)22-9-14(24)25/h6-7,10,26H,1-5,9H2,(H,22,27)(H,24,25) |
| InChIKey | VDPSKUNYECBYJK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|