About (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid
(2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid (PubChem CID 68847804) has the molecular formula C9H8F2O3
and a molecular weight of 202.16 g/mol. Its IUPAC name is (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid |
| PubChem CID | 68847804 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid |
| SMILES | C[C@@](O)(C(=O)O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H8F2O3/c1-9(14,8(12)13)5-2-6(10)4-7(11)3-5/h2-4,14H,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | PIRFKLCWZMSXPK-VIFPVBQESA-N |
| XLogP | 1.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid?
The IUPAC name of (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid (CID 68847804) is (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid.
What is the SMILES notation for (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid?
The canonical SMILES for (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid is C[C@@](O)(C(=O)O)c1cc(F)cc(F)c1.
What is the InChIKey of (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid?
The InChIKey is PIRFKLCWZMSXPK-VIFPVBQESA-N. The full InChI is InChI=1S/C9H8F2O3/c1-9(14,8(12)13)5-2-6(10)4-7(11)3-5/h2-4,14H,1H3,(H,12,13)/t9-/m0/s1.
What are the key properties of (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid?
(2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid has a molecular weight of 202.16 g/mol, XLogP of 1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3,5-difluorophenyl)-2-hydroxypropanoic acid is sourced from PubChem (CID 68847804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).