About tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride
tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride (PubChem CID 68848035) has the molecular formula C18H34ClN3O3
and a molecular weight of 375.94 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride |
| PubChem CID | 68848035 |
| Molecular Formula | C18H34ClN3O3 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CO.Cl.N#CCC1CCCCN1 |
| InChI | InChI=1S/C11H21NO3.C7H12N2.ClH/c1-11(2,3)15-10(14)12-7-5-4-6-9(12)8-13;8-5-4-7-3-1-2-6-9-7;/h9,13H,4-8H2,1-3H3;7,9H,1-4,6H2;1H |
| InChIKey | IXIGVVFEKMYPSU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride?
The IUPAC name of tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride (CID 68848035) is tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride.
What is the SMILES notation for tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride?
The canonical SMILES for tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride is CC(C)(C)OC(=O)N1CCCCC1CO.Cl.N#CCC1CCCCN1.
What is the InChIKey of tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride?
The InChIKey is IXIGVVFEKMYPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3.C7H12N2.ClH/c1-11(2,3)15-10(14)12-7-5-4-6-9(12)8-13;8-5-4-7-3-1-2-6-9-7;/h9,13H,4-8H2,1-3H3;7,9H,1-4,6H2;1H.
What are the key properties of tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride?
tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride has a molecular weight of 375.94 g/mol, XLogP of 3.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;2-piperidin-2-ylacetonitrile;hydrochloride is sourced from PubChem (CID 68848035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).