C19H26N4O2 — CID 68848241
[(4aS,6S,8aR)-6-amino-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-8a-yl]methanol (PubChem CID 68848241) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(4aS,6S,8aR)-6-amino-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-8a-yl]methanol.
| Compound Name | [(4aS,6S,8aR)-6-amino-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-8a-yl]methanol |
|---|---|
| PubChem CID | 68848241 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | [(4aS,6S,8aR)-6-amino-2-(6-methoxy-1,5-naphthyridin-4-yl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-8a-yl]methanol |
| SMILES | COc1ccc2nccc(N3CC[C@H]4C[C@@H](N)CC[C@]4(CO)C3)c2n1 |
| InChI | InChI=1S/C19H26N4O2/c1-25-17-3-2-15-18(22-17)16(5-8-21-15)23-9-6-13-10-14(20)4-7-19(13,11-23)12-24/h2-3,5,8,13-14,24H,4,6-7,9-12,20H2,1H3/t13-,14-,19+/m0/s1 |
| InChIKey | DIANYEJTVHQUMK-CKFHNAJUSA-N |
| XLogP | 1.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |