C18H26BClF3NO3S — CID 68848762
N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide (PubChem CID 68848762) has the molecular formula C18H26BClF3NO3S and a molecular weight of 439.74 g/mol. Its IUPAC name is N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 68848762 |
| Molecular Formula | C18H26BClF3NO3S |
| Molecular Weight | 439.74 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[1-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(c1ccc(B2OC(C)(C)C(C)(C)O2)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C18H26BClF3NO3S/c1-15(2,3)28(25)24-14(18(21,22)23)12-9-8-11(10-13(12)20)19-26-16(4,5)17(6,7)27-19/h8-10,14,24H,1-7H3 |
| InChIKey | UKNANUABXFEGBI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.74 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|