About 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine (PubChem CID 68848859) has the molecular formula C13H25N3OSi
and a molecular weight of 267.45 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine |
| PubChem CID | 68848859 |
| Molecular Formula | C13H25N3OSi |
| Molecular Weight | 267.45 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1cc(N)cnc1N |
| InChI | InChI=1S/C13H25N3OSi/c1-13(2,3)18(4,5)17-7-6-10-8-11(14)9-16-12(10)15/h8-9H,6-7,14H2,1-5H3,(H2,15,16) |
| InChIKey | YPXSLLLKKGWFRZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine?
The IUPAC name of 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine (CID 68848859) is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine.
What is the SMILES notation for 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine?
The canonical SMILES for 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine is CC(C)(C)[Si](C)(C)OCCc1cc(N)cnc1N.
What is the InChIKey of 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine?
The InChIKey is YPXSLLLKKGWFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3OSi/c1-13(2,3)18(4,5)17-7-6-10-8-11(14)9-16-12(10)15/h8-9H,6-7,14H2,1-5H3,(H2,15,16).
What are the key properties of 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine?
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine has a molecular weight of 267.45 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyridine-2,5-diamine is sourced from PubChem (CID 68848859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).