C29H42N4S+2 — CID 68848903
dimethyl-[3-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]quinolin-1-yl]propyl]-[3-(trimethylazaniumyl)propyl]azanium (PubChem CID 68848903) has the molecular formula C29H42N4S+2 and a molecular weight of 478.75 g/mol. Its IUPAC name is dimethyl-[3-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]quinolin-1-yl]propyl]-[3-(trimethylazaniumyl)propyl]azanium.
| Compound Name | dimethyl-[3-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]quinolin-1-yl]propyl]-[3-(trimethylazaniumyl)propyl]azanium |
|---|---|
| PubChem CID | 68848903 |
| Molecular Formula | C29H42N4S+2 |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | dimethyl-[3-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]quinolin-1-yl]propyl]-[3-(trimethylazaniumyl)propyl]azanium |
| SMILES | CN1c2ccccc2SC1C=C1C=CN(CCC[N+](C)(C)CCC[N+](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C29H42N4S/c1-30-27-15-9-10-16-28(27)34-29(30)23-24-17-19-31(26-14-8-7-13-25(24)26)18-11-21-33(5,6)22-12-20-32(2,3)4/h7-10,13-17,19,23,29H,11-12,18,20-22H2,1-6H3/q+2 |
| InChIKey | RCKIAQFIEBOKFK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|