C31H35F2N3O4 — CID 68848954
methyl 8-[6-[3-(2,5-difluorophenyl)prop-2-enylamino]-8a-(hydroxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-methoxyquinoline-5-carboxylate (PubChem CID 68848954) has the molecular formula C31H35F2N3O4 and a molecular weight of 551.63 g/mol. Its IUPAC name is methyl 8-[6-[3-(2,5-difluorophenyl)prop-2-enylamino]-8a-(hydroxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-methoxyquinoline-5-carboxylate.
| Compound Name | methyl 8-[6-[3-(2,5-difluorophenyl)prop-2-enylamino]-8a-(hydroxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-methoxyquinoline-5-carboxylate |
|---|---|
| PubChem CID | 68848954 |
| Molecular Formula | C31H35F2N3O4 |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | methyl 8-[6-[3-(2,5-difluorophenyl)prop-2-enylamino]-8a-(hydroxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-methoxyquinoline-5-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC3CC(NCC=Cc4cc(F)ccc4F)CCC3(CO)C2)c2nc(OC)ccc12 |
| InChI | InChI=1S/C31H35F2N3O4/c1-39-28-10-7-24-25(30(38)40-2)6-9-27(29(24)35-28)36-15-12-21-17-23(11-13-31(21,18-36)19-37)34-14-3-4-20-16-22(32)5-8-26(20)33/h3-10,16,21,23,34,37H,11-15,17-19H2,1-2H3 |
| InChIKey | JVGYGLRSQJRCQA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |