About 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid
2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid (PubChem CID 68849581) has the molecular formula C24H28Cl2N2O4
and a molecular weight of 479.40 g/mol. Its IUPAC name is 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid.
Molecular Properties
| Compound Name | 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid |
| PubChem CID | 68849581 |
| Molecular Formula | C24H28Cl2N2O4 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1CCO[C@H](CN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C24H28Cl2N2O4/c25-21-7-6-19(14-22(21)26)32-18-8-10-27(11-9-18)15-20-16-28(12-13-31-20)23(24(29)30)17-4-2-1-3-5-17/h1-7,14,18,20,23H,8-13,15-16H2,(H,29,30)/t20-,23?/m1/s1 |
| InChIKey | DCPIUFZZSDRFTC-PPUHSXQSSA-N |
| XLogP | 4.36 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid?
The IUPAC name of 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid (CID 68849581) is 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid.
What is the SMILES notation for 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid?
The canonical SMILES for 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid is O=C(O)C(c1ccccc1)N1CCO[C@H](CN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)C1.
What is the InChIKey of 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid?
The InChIKey is DCPIUFZZSDRFTC-PPUHSXQSSA-N. The full InChI is InChI=1S/C24H28Cl2N2O4/c25-21-7-6-19(14-22(21)26)32-18-8-10-27(11-9-18)15-20-16-28(12-13-31-20)23(24(29)30)17-4-2-1-3-5-17/h1-7,14,18,20,23H,8-13,15-16H2,(H,29,30)/t20-,23?/m1/s1.
What are the key properties of 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid?
2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid has a molecular weight of 479.40 g/mol, XLogP of 4.36, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-[[4-(3,4-dichlorophenoxy)piperidin-1-yl]methyl]morpholin-4-yl]-2-phenylacetic acid is sourced from PubChem (CID 68849581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).