About tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride
tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride (PubChem CID 68849642) has the molecular formula C17H35ClN2O4
and a molecular weight of 366.93 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride |
| PubChem CID | 68849642 |
| Molecular Formula | C17H35ClN2O4 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride |
| SMILES | CC1(O)CCN(C(=O)OC(C)(C)C)CC1.CC1(O)CCNCC1.Cl |
| InChI | InChI=1S/C11H21NO3.C6H13NO.ClH/c1-10(2,3)15-9(13)12-7-5-11(4,14)6-8-12;1-6(8)2-4-7-5-3-6;/h14H,5-8H2,1-4H3;7-8H,2-5H2,1H3;1H |
| InChIKey | NAOSGUDZQHOUKN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride?
The IUPAC name of tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride (CID 68849642) is tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride.
What is the SMILES notation for tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride?
The canonical SMILES for tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride is CC1(O)CCN(C(=O)OC(C)(C)C)CC1.CC1(O)CCNCC1.Cl.
What is the InChIKey of tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride?
The InChIKey is NAOSGUDZQHOUKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3.C6H13NO.ClH/c1-10(2,3)15-9(13)12-7-5-11(4,14)6-8-12;1-6(8)2-4-7-5-3-6;/h14H,5-8H2,1-4H3;7-8H,2-5H2,1H3;1H.
What are the key properties of tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride?
tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride has a molecular weight of 366.93 g/mol, XLogP of 2.31, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-hydroxy-4-methylpiperidine-1-carboxylate;4-methylpiperidin-4-ol;hydrochloride is sourced from PubChem (CID 68849642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).