C19H21Cl2N — CID 68849768
4,5-dichloro-2-(2,6-diethylphenyl)-5,6,7,8-tetrahydroquinoline (PubChem CID 68849768) has the molecular formula C19H21Cl2N and a molecular weight of 334.29 g/mol. Its IUPAC name is 4,5-dichloro-2-(2,6-diethylphenyl)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 4,5-dichloro-2-(2,6-diethylphenyl)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 68849768 |
| Molecular Formula | C19H21Cl2N |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4,5-dichloro-2-(2,6-diethylphenyl)-5,6,7,8-tetrahydroquinoline |
| SMILES | CCc1cccc(CC)c1-c1cc(Cl)c2c(n1)CCCC2Cl |
| InChI | InChI=1S/C19H21Cl2N/c1-3-12-7-5-8-13(4-2)18(12)17-11-15(21)19-14(20)9-6-10-16(19)22-17/h5,7-8,11,14H,3-4,6,9-10H2,1-2H3 |
| InChIKey | SWQLPMKNSHOXNJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|