C19H24N2O2 — CID 68849804
2-[1-(naphthalen-1-ylmethyl)piperidin-4-yl]ethylcarbamic acid (PubChem CID 68849804) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[1-(naphthalen-1-ylmethyl)piperidin-4-yl]ethylcarbamic acid.
| Compound Name | 2-[1-(naphthalen-1-ylmethyl)piperidin-4-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 68849804 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[1-(naphthalen-1-ylmethyl)piperidin-4-yl]ethylcarbamic acid |
| SMILES | O=C(O)NCCC1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C19H24N2O2/c22-19(23)20-11-8-15-9-12-21(13-10-15)14-17-6-3-5-16-4-1-2-7-18(16)17/h1-7,15,20H,8-14H2,(H,22,23) |
| InChIKey | OJGGNCZVAVUJBC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |