About CID 68850148
CID 68850148 (PubChem CID 68850148) has the molecular formula C28H40N6O7Si
and a molecular weight of 600.75 g/mol.
Molecular Properties
| Compound Name | CID 68850148 |
| PubChem CID | 68850148 |
| Molecular Formula | C28H40N6O7Si |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)C1OC(n2cc3c(N)cc4c(=O)[nH]ncc(n2)c34)C(C)(O)C1OC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C28H40N6O7Si/c1-26(2,3)42-41-27(4,5)22-23(39-20(35)7-8-33-9-11-38-12-10-33)28(6,37)25(40-22)34-15-17-18(29)13-16-21(17)19(32-34)14-30-31-24(16)36/h13-15,22-23,25,37H,7-12,29H2,1-6H3,(H,31,36) |
| InChIKey | FNQQOVUUXDQNLV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 167.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68850148 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68850148?
The IUPAC name of CID 68850148 (CID 68850148) is not available.
What is the SMILES notation for CID 68850148?
The canonical SMILES for CID 68850148 is CC(C)(C)[Si]OC(C)(C)C1OC(n2cc3c(N)cc4c(=O)[nH]ncc(n2)c34)C(C)(O)C1OC(=O)CCN1CCOCC1.
What is the InChIKey of CID 68850148?
The InChIKey is FNQQOVUUXDQNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H40N6O7Si/c1-26(2,3)42-41-27(4,5)22-23(39-20(35)7-8-33-9-11-38-12-10-33)28(6,37)25(40-22)34-15-17-18(29)13-16-21(17)19(32-34)14-30-31-24(16)36/h13-15,22-23,25,37H,7-12,29H2,1-6H3,(H,31,36).
What are the key properties of CID 68850148?
CID 68850148 has a molecular weight of 600.75 g/mol, XLogP of 1.77, 8 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68850148 is sourced from PubChem (CID 68850148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).