About (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid
(5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid (PubChem CID 68850436) has the molecular formula C10H11N3O3
and a molecular weight of 221.22 g/mol. Its IUPAC name is (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid.
Molecular Properties
| Compound Name | (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid |
| PubChem CID | 68850436 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid |
| SMILES | Nc1cccc2c1CC(NC(=O)O)C(=O)N2 |
| InChI | InChI=1S/C10H11N3O3/c11-6-2-1-3-7-5(6)4-8(9(14)12-7)13-10(15)16/h1-3,8,13H,4,11H2,(H,12,14)(H,15,16) |
| InChIKey | MYQAATUKIJKGIT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid?
The IUPAC name of (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid (CID 68850436) is (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid.
What is the SMILES notation for (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid?
The canonical SMILES for (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid is Nc1cccc2c1CC(NC(=O)O)C(=O)N2.
What is the InChIKey of (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid?
The InChIKey is MYQAATUKIJKGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3/c11-6-2-1-3-7-5(6)4-8(9(14)12-7)13-10(15)16/h1-3,8,13H,4,11H2,(H,12,14)(H,15,16).
What are the key properties of (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid?
(5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid has a molecular weight of 221.22 g/mol, XLogP of 0.40, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-2-oxo-3,4-dihydro-1H-quinolin-3-yl)carbamic acid is sourced from PubChem (CID 68850436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).