C40H37N3O2 — CID 68850467
1-(2-methylpropyl)-6-(3-tritylbenzimidazol-5-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 68850467) has the molecular formula C40H37N3O2 and a molecular weight of 591.76 g/mol. Its IUPAC name is 1-(2-methylpropyl)-6-(3-tritylbenzimidazol-5-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 1-(2-methylpropyl)-6-(3-tritylbenzimidazol-5-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 68850467 |
| Molecular Formula | C40H37N3O2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | 1-(2-methylpropyl)-6-(3-tritylbenzimidazol-5-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | CC(C)CC1c2ccc(-c3ccc4ncn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c4c3)cc2CCN1C(=O)O |
| InChI | InChI=1S/C40H37N3O2/c1-28(2)24-37-35-20-18-29(25-31(35)22-23-42(37)39(44)45)30-19-21-36-38(26-30)43(27-41-36)40(32-12-6-3-7-13-32,33-14-8-4-9-15-33)34-16-10-5-11-17-34/h3-21,25-28,37H,22-24H2,1-2H3,(H,44,45) |
| InChIKey | WLXVZWTWDKVPBS-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|