About 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol
3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol (PubChem CID 68850544) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol.
Molecular Properties
| Compound Name | 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol |
| PubChem CID | 68850544 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol |
| SMILES | OC1OCC=CC1c1cccs1 |
| InChI | InChI=1S/C9H10O2S/c10-9-7(3-1-5-11-9)8-4-2-6-12-8/h1-4,6-7,9-10H,5H2 |
| InChIKey | KMZHBYWCEUZBEQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol?
The IUPAC name of 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol (CID 68850544) is 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol.
What is the SMILES notation for 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol?
The canonical SMILES for 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol is OC1OCC=CC1c1cccs1.
What is the InChIKey of 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol?
The InChIKey is KMZHBYWCEUZBEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c10-9-7(3-1-5-11-9)8-4-2-6-12-8/h1-4,6-7,9-10H,5H2.
What are the key properties of 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol?
3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol has a molecular weight of 182.24 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-3,6-dihydro-2H-pyran-2-ol is sourced from PubChem (CID 68850544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).