C22H26N4O2S2 — CID 68850845
2-[[1-phenylsulfanyl-4-(pyridin-2-ylmethylamino)butan-2-yl]amino]benzenesulfonamide (PubChem CID 68850845) has the molecular formula C22H26N4O2S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 2-[[1-phenylsulfanyl-4-(pyridin-2-ylmethylamino)butan-2-yl]amino]benzenesulfonamide.
| Compound Name | 2-[[1-phenylsulfanyl-4-(pyridin-2-ylmethylamino)butan-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 68850845 |
| Molecular Formula | C22H26N4O2S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-[[1-phenylsulfanyl-4-(pyridin-2-ylmethylamino)butan-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(CCNCc1ccccn1)CSc1ccccc1 |
| InChI | InChI=1S/C22H26N4O2S2/c23-30(27,28)22-12-5-4-11-21(22)26-19(17-29-20-9-2-1-3-10-20)13-15-24-16-18-8-6-7-14-25-18/h1-12,14,19,24,26H,13,15-17H2,(H2,23,27,28) |
| InChIKey | HEABOJRVMLVAPF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|