About 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione
1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione (PubChem CID 68850884) has the molecular formula C18H10Cl2F3NO3
and a molecular weight of 416.18 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione.
Molecular Properties
| Compound Name | 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione |
| PubChem CID | 68850884 |
| Molecular Formula | C18H10Cl2F3NO3 |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC=Cc2ccc(Cl)c(Cl)c2)c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C18H10Cl2F3NO3/c19-13-5-3-10(8-14(13)20)2-1-7-24-15-6-4-11(27-18(21,22)23)9-12(15)16(25)17(24)26/h1-6,8-9H,7H2 |
| InChIKey | SIXYDOUAEMJQCW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione?
The IUPAC name of 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione (CID 68850884) is 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione.
What is the SMILES notation for 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione?
The canonical SMILES for 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione is O=C1C(=O)N(CC=Cc2ccc(Cl)c(Cl)c2)c2ccc(OC(F)(F)F)cc21.
What is the InChIKey of 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione?
The InChIKey is SIXYDOUAEMJQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl2F3NO3/c19-13-5-3-10(8-14(13)20)2-1-7-24-15-6-4-11(27-18(21,22)23)9-12(15)16(25)17(24)26/h1-6,8-9H,7H2.
What are the key properties of 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione?
1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione has a molecular weight of 416.18 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,4-dichlorophenyl)prop-2-enyl]-5-(trifluoromethoxy)indole-2,3-dione is sourced from PubChem (CID 68850884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).