C21H41NO5Si — CID 68850984
(2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 68850984) has the molecular formula C21H41NO5Si and a molecular weight of 415.65 g/mol. Its IUPAC name is (2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 68850984 |
| Molecular Formula | C21H41NO5Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | (2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[N+]1(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C21H41NO5Si/c1-19(2,3)17(23)26-14-15-12-16(27-28(10,11)21(7,8)9)13-22(15,18(24)25)20(4,5)6/h15-16H,12-14H2,1-11H3/t15-,16+,22?/m1/s1 |
| InChIKey | RSPKQSAZCBANTC-JWQBTQOVSA-N |
| XLogP | 3.70 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|