About N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine
N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine (PubChem CID 68851462) has the molecular formula C24H17F2N3O2
and a molecular weight of 417.42 g/mol. Its IUPAC name is N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine |
| PubChem CID | 68851462 |
| Molecular Formula | C24H17F2N3O2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine |
| SMILES | COc1cc(CN(c2ccccc2)c2nccc3occc23)c2ccc(F)c(F)c2n1 |
| InChI | InChI=1S/C24H17F2N3O2/c1-30-21-13-15(17-7-8-19(25)22(26)23(17)28-21)14-29(16-5-3-2-4-6-16)24-18-10-12-31-20(18)9-11-27-24/h2-13H,14H2,1H3 |
| InChIKey | AJPJPZNEIGSRFD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine?
The IUPAC name of N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine (CID 68851462) is N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine.
What is the SMILES notation for N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine?
The canonical SMILES for N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine is COc1cc(CN(c2ccccc2)c2nccc3occc23)c2ccc(F)c(F)c2n1.
What is the InChIKey of N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine?
The InChIKey is AJPJPZNEIGSRFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F2N3O2/c1-30-21-13-15(17-7-8-19(25)22(26)23(17)28-21)14-29(16-5-3-2-4-6-16)24-18-10-12-31-20(18)9-11-27-24/h2-13H,14H2,1H3.
What are the key properties of N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine?
N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine has a molecular weight of 417.42 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7,8-difluoro-2-methoxyquinolin-4-yl)methyl]-N-phenylfuro[3,2-c]pyridin-4-amine is sourced from PubChem (CID 68851462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).