About 1H-pyrrolo[1,2-a]azepine-8-carboxamide
1H-pyrrolo[1,2-a]azepine-8-carboxamide (PubChem CID 68851637) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1H-pyrrolo[1,2-a]azepine-8-carboxamide.
Molecular Properties
| Compound Name | 1H-pyrrolo[1,2-a]azepine-8-carboxamide |
| PubChem CID | 68851637 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1H-pyrrolo[1,2-a]azepine-8-carboxamide |
| SMILES | NC(=O)C1=CC=CN2C=CCC2=C1 |
| InChI | InChI=1S/C10H10N2O/c11-10(13)8-3-1-5-12-6-2-4-9(12)7-8/h1-3,5-7H,4H2,(H2,11,13) |
| InChIKey | RIFMJAXWGGPHFT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrrolo[1,2-a]azepine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[1,2-a]azepine-8-carboxamide?
The IUPAC name of 1H-pyrrolo[1,2-a]azepine-8-carboxamide (CID 68851637) is 1H-pyrrolo[1,2-a]azepine-8-carboxamide.
What is the SMILES notation for 1H-pyrrolo[1,2-a]azepine-8-carboxamide?
The canonical SMILES for 1H-pyrrolo[1,2-a]azepine-8-carboxamide is NC(=O)C1=CC=CN2C=CCC2=C1.
What is the InChIKey of 1H-pyrrolo[1,2-a]azepine-8-carboxamide?
The InChIKey is RIFMJAXWGGPHFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c11-10(13)8-3-1-5-12-6-2-4-9(12)7-8/h1-3,5-7H,4H2,(H2,11,13).
What are the key properties of 1H-pyrrolo[1,2-a]azepine-8-carboxamide?
1H-pyrrolo[1,2-a]azepine-8-carboxamide has a molecular weight of 174.20 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[1,2-a]azepine-8-carboxamide is sourced from PubChem (CID 68851637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).