About (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline
(1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline (PubChem CID 68851695) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline.
Molecular Properties
| Compound Name | (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline |
| PubChem CID | 68851695 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H](C)NC=C2 |
| InChI | InChI=1S/C12H15NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h4-8,13H,1-3H3/t8-/m0/s1 |
| InChIKey | TXHNFJRYPPFYLN-QMMMGPOBSA-N |
| XLogP | 2.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline?
The IUPAC name of (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline (CID 68851695) is (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline.
What is the SMILES notation for (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline?
The canonical SMILES for (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline is COc1cc2c(cc1OC)[C@H](C)NC=C2.
What is the InChIKey of (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline?
The InChIKey is TXHNFJRYPPFYLN-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H15NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h4-8,13H,1-3H3/t8-/m0/s1.
What are the key properties of (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline?
(1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline has a molecular weight of 205.26 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-6,7-dimethoxy-1-methyl-1,2-dihydroisoquinoline is sourced from PubChem (CID 68851695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).