About 1-prop-2-enyl-4,5-dihydroimidazol-2-amine
1-prop-2-enyl-4,5-dihydroimidazol-2-amine (PubChem CID 68852808) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 68852808 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| SMILES | C=CCN1CCN=C1N |
| InChI | InChI=1S/C6H11N3/c1-2-4-9-5-3-8-6(9)7/h2H,1,3-5H2,(H2,7,8) |
| InChIKey | MOBOCPDCLUOFNA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-prop-2-enyl-4,5-dihydroimidazol-2-amine (CID 68852808) is 1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-prop-2-enyl-4,5-dihydroimidazol-2-amine is C=CCN1CCN=C1N.
What is the InChIKey of 1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
The InChIKey is MOBOCPDCLUOFNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-2-4-9-5-3-8-6(9)7/h2H,1,3-5H2,(H2,7,8).
What are the key properties of 1-prop-2-enyl-4,5-dihydroimidazol-2-amine?
1-prop-2-enyl-4,5-dihydroimidazol-2-amine has a molecular weight of 125.17 g/mol, XLogP of -0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 68852808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).