About 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine
5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 68852810) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 68852810 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C=CCC1CN=C(N)N1 |
| InChI | InChI=1S/C6H11N3/c1-2-3-5-4-8-6(7)9-5/h2,5H,1,3-4H2,(H3,7,8,9) |
| InChIKey | XISCHOFTQDYPGL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine (CID 68852810) is 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine is C=CCC1CN=C(N)N1.
What is the InChIKey of 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is XISCHOFTQDYPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-2-3-5-4-8-6(7)9-5/h2,5H,1,3-4H2,(H3,7,8,9).
What are the key properties of 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 125.17 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 68852810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).