C17H22BrF3N2O4S — CID 68852935
(2S,4R)-4-[[2-bromo-5-(trifluoromethyl)phenyl]sulfonylamino]-1-tert-butyl-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 68852935) has the molecular formula C17H22BrF3N2O4S and a molecular weight of 487.34 g/mol. Its IUPAC name is (2S,4R)-4-[[2-bromo-5-(trifluoromethyl)phenyl]sulfonylamino]-1-tert-butyl-2-methylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2S,4R)-4-[[2-bromo-5-(trifluoromethyl)phenyl]sulfonylamino]-1-tert-butyl-2-methylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 68852935 |
| Molecular Formula | C17H22BrF3N2O4S |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | (2S,4R)-4-[[2-bromo-5-(trifluoromethyl)phenyl]sulfonylamino]-1-tert-butyl-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](NS(=O)(=O)c2cc(C(F)(F)F)ccc2Br)C[N+]1(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C17H22BrF3N2O4S/c1-10-7-12(9-23(10,15(24)25)16(2,3)4)22-28(26,27)14-8-11(17(19,20)21)5-6-13(14)18/h5-6,8,10,12,22H,7,9H2,1-4H3/t10-,12+,23?/m0/s1 |
| InChIKey | CSMNFQXFYVPYJQ-YNQIEPDCSA-N |
| XLogP | 2.87 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|