C40H41N13O2S — CID 68852937
2-[(6-aminopurin-9-yl)methyl]-3-cyclopentyl-5-methylquinazolin-4-one;3-cyclopentyl-5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one (PubChem CID 68852937) has the molecular formula C40H41N13O2S and a molecular weight of 767.92 g/mol. Its IUPAC name is 2-[(6-aminopurin-9-yl)methyl]-3-cyclopentyl-5-methylquinazolin-4-one;3-cyclopentyl-5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one.
| Compound Name | 2-[(6-aminopurin-9-yl)methyl]-3-cyclopentyl-5-methylquinazolin-4-one;3-cyclopentyl-5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 68852937 |
| Molecular Formula | C40H41N13O2S |
| Molecular Weight | 767.92 g/mol |
| Exact Mass | 767.32 |
| IUPAC Name | 2-[(6-aminopurin-9-yl)methyl]-3-cyclopentyl-5-methylquinazolin-4-one;3-cyclopentyl-5-methyl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
| SMILES | Cc1cccc2nc(CSc3ncnc4nc[nH]c34)n(C3CCCC3)c(=O)c12.Cc1cccc2nc(Cn3cnc4c(N)ncnc43)n(C3CCCC3)c(=O)c12 |
| InChI | InChI=1S/C20H21N7O.C20H20N6OS/c1-12-5-4-8-14-16(12)20(28)27(13-6-2-3-7-13)15(25-14)9-26-11-24-17-18(21)22-10-23-19(17)26;1-12-5-4-8-14-16(12)20(27)26(13-6-2-3-7-13)15(25-14)9-28-19-17-18(22-10-21-17)23-11-24-19/h4-5,8,10-11,13H,2-3,6-7,9H2,1H3,(H2,21,22,23);4-5,8,10-11,13H,2-3,6-7,9H2,1H3,(H,21,22,23,24) |
| InChIKey | KLEIEEMTMZBBJI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 193.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.92 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |