C15H28N2O4 — CID 68852977
(2R,4R)-4-amino-1-tert-butyl-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 68852977) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R,4R)-4-amino-1-tert-butyl-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2R,4R)-4-amino-1-tert-butyl-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 68852977 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | (2R,4R)-4-amino-1-tert-butyl-2-(2,2-dimethylpropanoyloxymethyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1C[C@@H](N)C[N+]1(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C15H28N2O4/c1-14(2,3)12(18)21-9-11-7-10(16)8-17(11,13(19)20)15(4,5)6/h10-11H,7-9,16H2,1-6H3/t10-,11-,17?/m1/s1 |
| InChIKey | UZEJUTNLOBHHEX-CSKHJBKKSA-N |
| XLogP | 0.63 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|