C20H24N4O — CID 6885304
N-[(E)-benzylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide (PubChem CID 6885304) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 6885304 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-(4-benzylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C20H24N4O/c25-20(22-21-15-18-7-3-1-4-8-18)17-24-13-11-23(12-14-24)16-19-9-5-2-6-10-19/h1-10,15H,11-14,16-17H2,(H,22,25)/b21-15+ |
| InChIKey | GKTAHEIFHHAQAK-RCCKNPSSSA-N |
| XLogP | 1.95 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|