About N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide
N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide (PubChem CID 68853294) has the molecular formula C21H29NO3
and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide.
Molecular Properties
| Compound Name | N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide |
| PubChem CID | 68853294 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2ccccc12)C(=O)CC |
| InChI | InChI=1S/C21H29NO3/c1-5-20(23)22(16(4)21(24-6-2)25-7-3)15-18-13-10-12-17-11-8-9-14-19(17)18/h8-14,16,21H,5-7,15H2,1-4H3/t16-/m0/s1 |
| InChIKey | YIOUWGVBZJEJDC-INIZCTEOSA-N |
| XLogP | 4.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide?
The IUPAC name of N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide (CID 68853294) is N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide.
What is the SMILES notation for N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide?
The canonical SMILES for N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide is CCOC(OCC)[C@H](C)N(Cc1cccc2ccccc12)C(=O)CC.
What is the InChIKey of N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide?
The InChIKey is YIOUWGVBZJEJDC-INIZCTEOSA-N. The full InChI is InChI=1S/C21H29NO3/c1-5-20(23)22(16(4)21(24-6-2)25-7-3)15-18-13-10-12-17-11-8-9-14-19(17)18/h8-14,16,21H,5-7,15H2,1-4H3/t16-/m0/s1.
What are the key properties of N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide?
N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide has a molecular weight of 343.47 g/mol, XLogP of 4.37, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1,1-diethoxypropan-2-yl]-N-(naphthalen-1-ylmethyl)propanamide is sourced from PubChem (CID 68853294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).