C21H28F2N6O2 — CID 68853472
4-N-[(1-tert-butylpiperidin-3-yl)methyl]-2-N-[(3,4-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 68853472) has the molecular formula C21H28F2N6O2 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-N-[(1-tert-butylpiperidin-3-yl)methyl]-2-N-[(3,4-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[(1-tert-butylpiperidin-3-yl)methyl]-2-N-[(3,4-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68853472 |
| Molecular Formula | C21H28F2N6O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-N-[(1-tert-butylpiperidin-3-yl)methyl]-2-N-[(3,4-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | CC(C)(C)N1CCCC(CNc2nc(NCc3ccc(F)c(F)c3)ncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H28F2N6O2/c1-21(2,3)28-8-4-5-15(13-28)11-24-19-18(29(30)31)12-26-20(27-19)25-10-14-6-7-16(22)17(23)9-14/h6-7,9,12,15H,4-5,8,10-11,13H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | CCAOSXAPZZPMBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|