About 4-(1,2-oxazol-5-yl)aniline;hydrochloride
4-(1,2-oxazol-5-yl)aniline;hydrochloride (PubChem CID 68853473) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 4-(1,2-oxazol-5-yl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-(1,2-oxazol-5-yl)aniline;hydrochloride |
| PubChem CID | 68853473 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 4-(1,2-oxazol-5-yl)aniline;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2ccno2)cc1 |
| InChI | InChI=1S/C9H8N2O.ClH/c10-8-3-1-7(2-4-8)9-5-6-11-12-9;/h1-6H,10H2;1H |
| InChIKey | BZMNTSRVARVFAZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2-oxazol-5-yl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-oxazol-5-yl)aniline;hydrochloride?
The IUPAC name of 4-(1,2-oxazol-5-yl)aniline;hydrochloride (CID 68853473) is 4-(1,2-oxazol-5-yl)aniline;hydrochloride.
What is the SMILES notation for 4-(1,2-oxazol-5-yl)aniline;hydrochloride?
The canonical SMILES for 4-(1,2-oxazol-5-yl)aniline;hydrochloride is Cl.Nc1ccc(-c2ccno2)cc1.
What is the InChIKey of 4-(1,2-oxazol-5-yl)aniline;hydrochloride?
The InChIKey is BZMNTSRVARVFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.ClH/c10-8-3-1-7(2-4-8)9-5-6-11-12-9;/h1-6H,10H2;1H.
What are the key properties of 4-(1,2-oxazol-5-yl)aniline;hydrochloride?
4-(1,2-oxazol-5-yl)aniline;hydrochloride has a molecular weight of 196.64 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-oxazol-5-yl)aniline;hydrochloride is sourced from PubChem (CID 68853473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).