About 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol
1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol (PubChem CID 68853711) has the molecular formula C17H19F2N5OS
and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol |
| PubChem CID | 68853711 |
| Molecular Formula | C17H19F2N5OS |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol |
| SMILES | CCCCSc1nc(N)c2ncn(C(O)Cc3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C17H19F2N5OS/c1-2-3-7-26-17-22-15(20)14-16(23-17)24(9-21-14)13(25)8-10-11(18)5-4-6-12(10)19/h4-6,9,13,25H,2-3,7-8H2,1H3,(H2,20,22,23) |
| InChIKey | NCWPKPPQINYHIA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol?
The IUPAC name of 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol (CID 68853711) is 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol.
What is the SMILES notation for 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol?
The canonical SMILES for 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol is CCCCSc1nc(N)c2ncn(C(O)Cc3c(F)cccc3F)c2n1.
What is the InChIKey of 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol?
The InChIKey is NCWPKPPQINYHIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2N5OS/c1-2-3-7-26-17-22-15(20)14-16(23-17)24(9-21-14)13(25)8-10-11(18)5-4-6-12(10)19/h4-6,9,13,25H,2-3,7-8H2,1H3,(H2,20,22,23).
What are the key properties of 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol?
1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol has a molecular weight of 379.44 g/mol, XLogP of 3.31, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2-butylsulfanylpurin-9-yl)-2-(2,6-difluorophenyl)ethanol is sourced from PubChem (CID 68853711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).