C28H32N8 — CID 68853833
3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-isoquinolin-1-yl-1,2,4-triazole-3,5-diamine (PubChem CID 68853833) has the molecular formula C28H32N8 and a molecular weight of 480.62 g/mol. Its IUPAC name is 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-isoquinolin-1-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-isoquinolin-1-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 68853833 |
| Molecular Formula | C28H32N8 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-isoquinolin-1-yl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCN(C4CC5CCC4C5)CC3)cc2)nn1-c1nccc2ccccc12 |
| InChI | InChI=1S/C28H32N8/c29-27-32-28(33-36(27)26-24-4-2-1-3-20(24)11-12-30-26)31-22-7-9-23(10-8-22)34-13-15-35(16-14-34)25-18-19-5-6-21(25)17-19/h1-4,7-12,19,21,25H,5-6,13-18H2,(H3,29,31,32,33) |
| InChIKey | GHJCUXDFXLKDLW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|