C19H19N5O6 — CID 68854207
(E)-but-2-enedioic acid;(2S)-1-[7-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-g]indazol-1-yl]propan-2-amine (PubChem CID 68854207) has the molecular formula C19H19N5O6 and a molecular weight of 413.39 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2S)-1-[7-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-g]indazol-1-yl]propan-2-amine.
| Compound Name | (E)-but-2-enedioic acid;(2S)-1-[7-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-g]indazol-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 68854207 |
| Molecular Formula | C19H19N5O6 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (E)-but-2-enedioic acid;(2S)-1-[7-(3-methyl-1,2,4-oxadiazol-5-yl)furo[2,3-g]indazol-1-yl]propan-2-amine |
| SMILES | Cc1noc(-c2cc3c(ccc4cnn(C[C@H](C)N)c43)o2)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H15N5O2.C4H4O4/c1-8(16)7-20-14-10(6-17-20)3-4-12-11(14)5-13(21-12)15-18-9(2)19-22-15;5-3(6)1-2-4(7)8/h3-6,8H,7,16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t8-;/m0./s1 |
| InChIKey | AXXLMISDDKTLLE-LOOJJACZSA-N |
| XLogP | 2.20 |
| TPSA | 170.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|