C20H17F2N5O — CID 68854529
4-[(8-cyclobutyl-6-methylpurin-9-yl)methyl]-7,8-difluoro-1H-quinolin-2-one (PubChem CID 68854529) has the molecular formula C20H17F2N5O and a molecular weight of 381.39 g/mol. Its IUPAC name is 4-[(8-cyclobutyl-6-methylpurin-9-yl)methyl]-7,8-difluoro-1H-quinolin-2-one.
| Compound Name | 4-[(8-cyclobutyl-6-methylpurin-9-yl)methyl]-7,8-difluoro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68854529 |
| Molecular Formula | C20H17F2N5O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-[(8-cyclobutyl-6-methylpurin-9-yl)methyl]-7,8-difluoro-1H-quinolin-2-one |
| SMILES | Cc1ncnc2c1nc(C1CCC1)n2Cc1cc(=O)[nH]c2c(F)c(F)ccc12 |
| InChI | InChI=1S/C20H17F2N5O/c1-10-17-20(24-9-23-10)27(19(26-17)11-3-2-4-11)8-12-7-15(28)25-18-13(12)5-6-14(21)16(18)22/h5-7,9,11H,2-4,8H2,1H3,(H,25,28) |
| InChIKey | JXOOGSODONUWHF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |