About (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride
(E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride (PubChem CID 68854835) has the molecular formula C12H19ClN2O
and a molecular weight of 242.75 g/mol. Its IUPAC name is (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride |
| PubChem CID | 68854835 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride |
| SMILES | CN[C@@H](C)C/C=C/c1cncc(OC)c1.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-10(13-2)5-4-6-11-7-12(15-3)9-14-8-11;/h4,6-10,13H,5H2,1-3H3;1H/b6-4+;/t10-;/m0./s1 |
| InChIKey | FARSKHAFHAMJMW-UMCLVOGKSA-N |
| XLogP | 2.52 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride?
The IUPAC name of (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride (CID 68854835) is (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride.
What is the SMILES notation for (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride?
The canonical SMILES for (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride is CN[C@@H](C)C/C=C/c1cncc(OC)c1.Cl.
What is the InChIKey of (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride?
The InChIKey is FARSKHAFHAMJMW-UMCLVOGKSA-N. The full InChI is InChI=1S/C12H18N2O.ClH/c1-10(13-2)5-4-6-11-7-12(15-3)9-14-8-11;/h4,6-10,13H,5H2,1-3H3;1H/b6-4+;/t10-;/m0./s1.
What are the key properties of (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride?
(E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride has a molecular weight of 242.75 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-5-(5-methoxy-3-pyridinyl)-N-methylpent-4-en-2-amine;hydrochloride is sourced from PubChem (CID 68854835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).