C21H24N2O5S — CID 68855492
2-methoxy-6-methyl-N-(7-piperidin-4-yloxy-1-benzofuran-5-yl)benzenesulfonamide (PubChem CID 68855492) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-methoxy-6-methyl-N-(7-piperidin-4-yloxy-1-benzofuran-5-yl)benzenesulfonamide.
| Compound Name | 2-methoxy-6-methyl-N-(7-piperidin-4-yloxy-1-benzofuran-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 68855492 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-methoxy-6-methyl-N-(7-piperidin-4-yloxy-1-benzofuran-5-yl)benzenesulfonamide |
| SMILES | COc1cccc(C)c1S(=O)(=O)Nc1cc(OC2CCNCC2)c2occc2c1 |
| InChI | InChI=1S/C21H24N2O5S/c1-14-4-3-5-18(26-2)21(14)29(24,25)23-16-12-15-8-11-27-20(15)19(13-16)28-17-6-9-22-10-7-17/h3-5,8,11-13,17,22-23H,6-7,9-10H2,1-2H3 |
| InChIKey | WACMHBTVQBSOKO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |