About 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine
4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine (PubChem CID 68855582) has the molecular formula C17H18F3N3
and a molecular weight of 321.35 g/mol. Its IUPAC name is 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine |
| PubChem CID | 68855582 |
| Molecular Formula | C17H18F3N3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine |
| SMILES | CC(C)N1C=CNC2=C1C(c1ccc(C(F)(F)F)cc1)=NCC2 |
| InChI | InChI=1S/C17H18F3N3/c1-11(2)23-10-9-21-14-7-8-22-15(16(14)23)12-3-5-13(6-4-12)17(18,19)20/h3-6,9-11,21H,7-8H2,1-2H3 |
| InChIKey | VJIVWFQWUUQMKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine?
The IUPAC name of 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine (CID 68855582) is 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine.
What is the SMILES notation for 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine?
The canonical SMILES for 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine is CC(C)N1C=CNC2=C1C(c1ccc(C(F)(F)F)cc1)=NCC2.
What is the InChIKey of 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine?
The InChIKey is VJIVWFQWUUQMKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3N3/c1-11(2)23-10-9-21-14-7-8-22-15(16(14)23)12-3-5-13(6-4-12)17(18,19)20/h3-6,9-11,21H,7-8H2,1-2H3.
What are the key properties of 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine?
4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine has a molecular weight of 321.35 g/mol, XLogP of 3.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-5-[4-(trifluoromethyl)phenyl]-7,8-dihydro-1H-pyrido[3,4-b]pyrazine is sourced from PubChem (CID 68855582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).