About 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide
1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide (PubChem CID 68856085) has the molecular formula C22H39BrN2O6S2
and a molecular weight of 571.60 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide.
Molecular Properties
| Compound Name | 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide |
| PubChem CID | 68856085 |
| Molecular Formula | C22H39BrN2O6S2 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide |
| SMILES | Br.CCN(CC)C(C)OC(=O)CCCc1ccc(N(CCS(C)(=O)=O)CCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H38N2O6S2.BrH/c1-6-23(7-2)19(3)30-22(25)10-8-9-20-11-13-21(14-12-20)24(15-17-31(4,26)27)16-18-32(5,28)29;/h11-14,19H,6-10,15-18H2,1-5H3;1H |
| InChIKey | AFVNCDFNFHLKHG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide?
The IUPAC name of 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide (CID 68856085) is 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide.
What is the SMILES notation for 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide?
The canonical SMILES for 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide is Br.CCN(CC)C(C)OC(=O)CCCc1ccc(N(CCS(C)(=O)=O)CCS(C)(=O)=O)cc1.
What is the InChIKey of 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide?
The InChIKey is AFVNCDFNFHLKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38N2O6S2.BrH/c1-6-23(7-2)19(3)30-22(25)10-8-9-20-11-13-21(14-12-20)24(15-17-31(4,26)27)16-18-32(5,28)29;/h11-14,19H,6-10,15-18H2,1-5H3;1H.
What are the key properties of 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide?
1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide has a molecular weight of 571.60 g/mol, XLogP of 2.71, 15 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)ethyl 4-[4-[bis(2-methylsulfonylethyl)amino]phenyl]butanoate;hydrobromide is sourced from PubChem (CID 68856085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).