About 1,3-dihydroimidazo[4,5-b]pyrazin-2-one
1,3-dihydroimidazo[4,5-b]pyrazin-2-one (PubChem CID 68856140) has the molecular formula C10H8N8O2
and a molecular weight of 272.23 g/mol. Its IUPAC name is 1,3-dihydroimidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 68856140 |
| Molecular Formula | C10H8N8O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2nccnc2[nH]1.O=c1[nH]c2nccnc2[nH]1 |
| InChI | InChI=1S/2C5H4N4O/c2*10-5-8-3-4(9-5)7-2-1-6-3/h2*1-2H,(H2,6,7,8,9,10) |
| InChIKey | YRBFLRJJXXGYKJ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 148.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dihydroimidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 1,3-dihydroimidazo[4,5-b]pyrazin-2-one (CID 68856140) is 1,3-dihydroimidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 1,3-dihydroimidazo[4,5-b]pyrazin-2-one is O=c1[nH]c2nccnc2[nH]1.O=c1[nH]c2nccnc2[nH]1.
What is the InChIKey of 1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The InChIKey is YRBFLRJJXXGYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H4N4O/c2*10-5-8-3-4(9-5)7-2-1-6-3/h2*1-2H,(H2,6,7,8,9,10).
What are the key properties of 1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
1,3-dihydroimidazo[4,5-b]pyrazin-2-one has a molecular weight of 272.23 g/mol, XLogP of -0.71, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroimidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 68856140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).