About N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide
N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide (PubChem CID 68856359) has the molecular formula C13H24FNO
and a molecular weight of 229.34 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide |
| PubChem CID | 68856359 |
| Molecular Formula | C13H24FNO |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide |
| SMILES | CC1(C)CCC(NC(=O)C(C)(C)CF)CC1 |
| InChI | InChI=1S/C13H24FNO/c1-12(2)7-5-10(6-8-12)15-11(16)13(3,4)9-14/h10H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | YMLSEUNMZWDFGY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide?
The IUPAC name of N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide (CID 68856359) is N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide.
What is the SMILES notation for N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide?
The canonical SMILES for N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide is CC1(C)CCC(NC(=O)C(C)(C)CF)CC1.
What is the InChIKey of N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide?
The InChIKey is YMLSEUNMZWDFGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24FNO/c1-12(2)7-5-10(6-8-12)15-11(16)13(3,4)9-14/h10H,5-9H2,1-4H3,(H,15,16).
What are the key properties of N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide?
N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide has a molecular weight of 229.34 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylcyclohexyl)-3-fluoro-2,2-dimethylpropanamide is sourced from PubChem (CID 68856359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).