About (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide
(3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide (PubChem CID 68856592) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide.
Molecular Properties
| Compound Name | (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide |
| PubChem CID | 68856592 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1N=Cc2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H13N3O2/c17-15(20)14-16(21)19(12-7-2-1-3-8-12)13-9-5-4-6-11(13)10-18-14/h1-10,14H,(H2,17,20)/t14-/m0/s1 |
| InChIKey | XRXXESQEMUUDBO-AWEZNQCLSA-N |
| XLogP | 1.64 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide?
The IUPAC name of (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide (CID 68856592) is (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide.
What is the SMILES notation for (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide?
The canonical SMILES for (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide is NC(=O)[C@@H]1N=Cc2ccccc2N(c2ccccc2)C1=O.
What is the InChIKey of (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide?
The InChIKey is XRXXESQEMUUDBO-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H13N3O2/c17-15(20)14-16(21)19(12-7-2-1-3-8-12)13-9-5-4-6-11(13)10-18-14/h1-10,14H,(H2,17,20)/t14-/m0/s1.
What are the key properties of (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide?
(3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide has a molecular weight of 279.30 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-oxo-1-phenyl-3H-1,4-benzodiazepine-3-carboxamide is sourced from PubChem (CID 68856592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).